CAS 35557-82-5 is the registry number for Hexachloronaphthalene-1,8-disulfide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
5,6,7,9,10,11-hexachloro-2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (CAS 35557-82-5) is a chemical compound with the molecular formula C10Cl6S2 and a molecular weight of 396.9 g/mol. IUPAC name: 5,6,7,9,10,11-hexachloro-2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene. InChIKey: QNAGJDKBSXZJGV-UHFFFAOYSA-N.
| Molecular formula | C10Cl6S2 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | 5,6,7,9,10,11-hexachloro-2,3-dithiatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| InChIKey | QNAGJDKBSXZJGV-UHFFFAOYSA-N |
| SMILES | C12=C3C(=C(C(=C1SSC2=C(C(=C3Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)