Products 35558-49-7
CAS 35558-49-7 appears in our catalog under these names: Bromocyclohexane-d11, 98 atom % D, min 98% Chemical Purity, Bromocyclohexane–d11, BROMOCYCLOHEXANE-D11, >=98 ATOM % D, >=&, Bromocyclohexane-d11, 98.09%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 0,5g, 10mg, 100mg, 25mg, 50mg, 5G, 50 mg.
1-bromo-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane (CAS 35558-49-7) is a chemical compound with the molecular formula C6H11Br and a molecular weight of 174.12 g/mol. IUPAC name: 1-bromo-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane. InChIKey: AQNQQHJNRPDOQV-KAFHOZLVSA-N.
| Molecular formula | C6H11Br |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | 1-bromo-1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexane |
| InChIKey | AQNQQHJNRPDOQV-KAFHOZLVSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])Br)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)