Products 355809-53-9

CAS 355809-53-9 is the registry number for 2-(2-(2-(4-Bromophenoxy)acetyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[[2-(4-bromophenoxy)acetyl]amino]carbamoyl]benzoic acid (CAS 355809-53-9) is a chemical compound with the molecular formula C16H13BrN2O5 and a molecular weight of 393.19 g/mol. IUPAC name: 2-[[[2-(4-bromophenoxy)acetyl]amino]carbamoyl]benzoic acid. InChIKey: WVCBPIODEBEJKV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13BrN2O5
Molecular weight393.19 g/mol
IUPAC name2-[[[2-(4-bromophenoxy)acetyl]amino]carbamoyl]benzoic acid
InChIKeyWVCBPIODEBEJKV-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NNC(=O)COC2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)