CAS 35592-95-1 appears in our catalog under these names: Trichloropyridine-3,5-dicarboxylic acid, 98%, Trichloropyridine-3,5-dicarboxylic acid, 2,4,6-Trichloropyridine-3,5-Dicarboxylic Acid, 97%(HPLC),RG, 97%(HPLC),RG, 2,4,6-Trichloropyridine-3,5-dicarboxylic acid, 97%(HPLC),RG. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g.
2,4,6-trichloropyridine-3,5-dicarboxylic acid (CAS 35592-95-1) is a chemical compound with the molecular formula C7H2Cl3NO4 and a molecular weight of 270.4 g/mol. IUPAC name: 2,4,6-trichloropyridine-3,5-dicarboxylic acid. InChIKey: HVBUPKJCSNMDEO-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NO4 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 2,4,6-trichloropyridine-3,5-dicarboxylic acid |
| InChIKey | HVBUPKJCSNMDEO-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(N=C1Cl)Cl)C(=O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)