CAS 35592-96-2 appears in our catalog under these names: Methyl 3,4,5,6-tetrachloropyridine-2-carboxylate, 98%, Methyl 3,4,5,6-tetrachloropicolinate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3,4,5,6-tetrachloropyridine-2-carboxylate (CAS 35592-96-2) is a chemical compound with the molecular formula C7H3Cl4NO2 and a molecular weight of 274.9 g/mol. IUPAC name: methyl 3,4,5,6-tetrachloropyridine-2-carboxylate. InChIKey: RYIFDLNTADZCRH-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl4NO2 |
|---|---|
| Molecular weight | 274.9 g/mol |
| IUPAC name | methyl 3,4,5,6-tetrachloropyridine-2-carboxylate |
| InChIKey | RYIFDLNTADZCRH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C(=C1Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)