CAS 356-69-4 appears in our catalog under these names: methyl 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanoate, 95%, Methyl 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
Methyl 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanoate (CAS 356-69-4) is a chemical compound with the molecular formula C5H3F7O3 and a molecular weight of 244.06 g/mol. IUPAC name: methyl 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanoate. InChIKey: CTFPDAPIMZVSSO-UHFFFAOYSA-N.
| Molecular formula | C5H3F7O3 |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | methyl 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propanoate |
| InChIKey | CTFPDAPIMZVSSO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(OC(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)