Products 3560-17-6
CAS 3560-17-6 is the registry number for Boc-Cys(Bzl)-ONp. Offered by: Creative Peptides. Available pack sizes: 5g, 25g.
(4-nitrophenyl) 3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 3560-17-6) is a chemical compound with the molecular formula C21H24N2O6S and a molecular weight of 432.5 g/mol. IUPAC name: (4-nitrophenyl) 3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: DEQZTANESNRFKU-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O6S |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (4-nitrophenyl) 3-benzylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | DEQZTANESNRFKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CSCC1=CC=CC=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)