CAS 356058-14-5 appears in our catalog under these names: 6-(4-(trifluoromethyl)phenyl)nicotinaldehyde, ≥95%, ≥95%, 6-(4-(trifluoromethyl)phenyl)nicotinaldehyde. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
6-[4-(trifluoromethyl)phenyl]pyridine-3-carbaldehyde (CAS 356058-14-5) is a chemical compound with the molecular formula C13H8F3NO and a molecular weight of 251.20 g/mol. IUPAC name: 6-[4-(trifluoromethyl)phenyl]pyridine-3-carbaldehyde. InChIKey: ORGBUOFMDHPPIX-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO |
|---|---|
| Molecular weight | 251.20 g/mol |
| IUPAC name | 6-[4-(trifluoromethyl)phenyl]pyridine-3-carbaldehyde |
| InChIKey | ORGBUOFMDHPPIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=C2)C=O)C(F)(F)F |
Computed by PubChem (NCBI)