CAS 356058-18-9 appears in our catalog under these names: (4'-(Trifluoromethyl)-(1,1'-biphenyl)-4-yl)methanamine, 95%, 1-(4'-(Trifluoromethyl)-4-Biphenylyl)Methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 500mg.
[4-[4-(trifluoromethyl)phenyl]phenyl]methanamine (CAS 356058-18-9) is a chemical compound with the molecular formula C14H12F3N and a molecular weight of 251.25 g/mol. IUPAC name: [4-[4-(trifluoromethyl)phenyl]phenyl]methanamine. InChIKey: RVNFCJGQVWHMKN-UHFFFAOYSA-N.
| Molecular formula | C14H12F3N |
|---|---|
| Molecular weight | 251.25 g/mol |
| IUPAC name | [4-[4-(trifluoromethyl)phenyl]phenyl]methanamine |
| InChIKey | RVNFCJGQVWHMKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)