CAS 35607-27-3 appears in our catalog under these names: 3-(3-pyridinyl)-1H-1,2,4-triazol-5-amine, 5-(Pyridin-3-yl)-4h-1,2,4-triazol-3-amine, 95%, 3-Pyridin-3-yl-1h-1,2,4-triazol-5-amine, 97%, 3-(Pyridin-3-yl)-1H-1,2,4-triazol-5-amine, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
5-pyridin-3-yl-1H-1,2,4-triazol-3-amine (CAS 35607-27-3) is a chemical compound with the molecular formula C7H7N5 and a molecular weight of 161.16 g/mol. IUPAC name: 5-pyridin-3-yl-1H-1,2,4-triazol-3-amine. InChIKey: USTVEFNDQUIZNC-UHFFFAOYSA-N.
| Molecular formula | C7H7N5 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-pyridin-3-yl-1H-1,2,4-triazol-3-amine |
| InChIKey | USTVEFNDQUIZNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=NN2)N |
Computed by PubChem (NCBI)