CAS 3564-14-5 appears in our catalog under these names: Eriochrome blue–black B (C·I· 14640), metal indicator, Eriochrome|r Blue Black B , Eriochrome blue-black B (C.I. 14640), 40.00%, Eriochrome Blue Black B, IND, IND, Erichrome blue black B. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress, Roth. Available pack sizes: 100g, 500g, 25g, Get quote, 5g.
Sodium 3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate (CAS 3564-14-5) is a chemical compound with the molecular formula C20H13N2NaO5S and a molecular weight of 416.4 g/mol. IUPAC name: sodium 3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate. InChIKey: HOWITLLZNKSJOJ-UHFFFAOYSA-M.
| Molecular formula | C20H13N2NaO5S |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | sodium 3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate |
| InChIKey | HOWITLLZNKSJOJ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2O)N=NC3=C(C=C(C4=CC=CC=C43)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)