CAS 3564-21-4 is the registry number for Pigment red 48 (C.I. 15865). Offered by: Biosynth. Available pack sizes: 5g.
Disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate (CAS 3564-21-4) is a chemical compound with the molecular formula C18H11ClN2Na2O6S and a molecular weight of 464.8 g/mol. IUPAC name: disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate. InChIKey: NDEREBNOSVNICA-UHFFFAOYSA-L.
| Molecular formula | C18H11ClN2Na2O6S |
|---|---|
| Molecular weight | 464.8 g/mol |
| IUPAC name | disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate |
| InChIKey | NDEREBNOSVNICA-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C=C1Cl)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)