Products 356526-74-4

CAS 356526-74-4 is the registry number for 2-(2-(3,4,5-Trimethoxybenzoyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]benzoic acid (CAS 356526-74-4) is a chemical compound with the molecular formula C18H18N2O7 and a molecular weight of 374.3 g/mol. IUPAC name: 2-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]benzoic acid. InChIKey: ISJNFTFUDOGMHE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2O7
Molecular weight374.3 g/mol
IUPAC name2-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]benzoic acid
InChIKeyISJNFTFUDOGMHE-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(=O)NNC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)