CAS 3566-25-4 is the registry number for Homofolic Acid. Offered by: TRC. Available pack sizes: 200mg.
(2S)-2-[[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylamino]benzoyl]amino]pentanedioic acid (CAS 3566-25-4) is a chemical compound with the molecular formula C20H21N7O6 and a molecular weight of 455.4 g/mol. IUPAC name: (2S)-2-[[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylamino]benzoyl]amino]pentanedioic acid. InChIKey: QXARTGUOGAZGKO-ZDUSSCGKSA-N.
| Molecular formula | C20H21N7O6 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | (2S)-2-[[4-[2-(2-amino-4-oxo-3H-pteridin-6-yl)ethylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | QXARTGUOGAZGKO-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)