CAS 3567-18-8 appears in our catalog under these names: 2,2-Dichloro-1,1-bis(4-chlorophenyl)ethanol, Dicofol-2-deschloro. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 500mg, 50mg.
2,2-dichloro-1,1-bis(4-chlorophenyl)ethanol (CAS 3567-18-8) is a chemical compound with the molecular formula C14H10Cl4O and a molecular weight of 336.0 g/mol. IUPAC name: 2,2-dichloro-1,1-bis(4-chlorophenyl)ethanol. InChIKey: NVUMAPVZONTQRR-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl4O |
|---|---|
| Molecular weight | 336.0 g/mol |
| IUPAC name | 2,2-dichloro-1,1-bis(4-chlorophenyl)ethanol |
| InChIKey | NVUMAPVZONTQRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)(C(Cl)Cl)O)Cl |
Computed by PubChem (NCBI)