CAS 3567-66-6 is the registry number for Acid Red 33. Offered by: Dr. Ehrenstorfer, Sigma-Aldrich, Chemat. Available pack sizes: 25mg.
Disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate (CAS 3567-66-6) is a chemical compound with the molecular formula C16H11N3Na2O7S2 and a molecular weight of 467.4 g/mol. IUPAC name: disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate. InChIKey: LQJVOKWHGUAUHK-UHFFFAOYSA-L.
| Molecular formula | C16H11N3Na2O7S2 |
|---|---|
| Molecular weight | 467.4 g/mol |
| IUPAC name | disodium;5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate |
| InChIKey | LQJVOKWHGUAUHK-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])N)O.[Na+].[Na+] |
Computed by PubChem (NCBI)