CAS 356783-29-4 appears in our catalog under these names: Favipiravir Impurity 12, Des-(3-Oxo-3,4-dihydrogen) 3,6-Difluoro Favipiravir, 3,6-Difluoropyrazine-2-carboxamide, 3,6–Difluoropyrazine–2–carboxamide, 3,6-Difluoropyrazine-2-carboxamide 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 100mg, 25mg, 250mg, 1g.
3,6-difluoropyrazine-2-carboxamide (CAS 356783-29-4) is a chemical compound with the molecular formula C5H3F2N3O and a molecular weight of 159.09 g/mol. IUPAC name: 3,6-difluoropyrazine-2-carboxamide. InChIKey: WIQUNYNMYIJSCV-UHFFFAOYSA-N.
| Molecular formula | C5H3F2N3O |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 3,6-difluoropyrazine-2-carboxamide |
| InChIKey | WIQUNYNMYIJSCV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)F)C(=O)N)F |
Computed by PubChem (NCBI)