Products 3568-51-2
CAS 3568-51-2 is the registry number for Bayer 16574. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloroethyl 2,2-dichloroethenyl ethyl phosphate (CAS 3568-51-2) is a chemical compound with the molecular formula C6H10Cl3O4P and a molecular weight of 283.5 g/mol. IUPAC name: 2-chloroethyl 2,2-dichloroethenyl ethyl phosphate. InChIKey: MXFVWCLDTWOWKM-UHFFFAOYSA-N.
| Molecular formula | C6H10Cl3O4P |
|---|---|
| Molecular weight | 283.5 g/mol |
| IUPAC name | 2-chloroethyl 2,2-dichloroethenyl ethyl phosphate |
| InChIKey | MXFVWCLDTWOWKM-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCCCl)OC=C(Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-chloroethyl 2,2-dichloroethenyl ethyl phosphate, Bayer 16574, Phosphoric acid, 2-chloroethyl 2,2-dichloroethenyl ethyl ester, 2-Chloroethyl (2,2-dichlorovinyl) ethyl phosphate, 2-Chloroethyl-2,2-dichlorovinyl ethyl phosphate, Phosphoric acid, 2-chloroethyl-2,2-dichlorovinyl ethyl ester, starbld0007565, Phosphoric acid, 2-chloroethyl-2,2-dichloroethenyl ethyl ester, orb1703774, 2-Chloroethyl 2,2-dichloroethen-1-yl ethyl phosphate