CAS 35684-65-2 is the registry number for (2R,3S)-3-Aminopyrrolidine-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-3-aminopyrrolidine-2-carboxylic acid;hydrochloride (CAS 35684-65-2) is a chemical compound with the molecular formula C5H11ClN2O2 and a molecular weight of 166.60 g/mol. IUPAC name: (2S,3R)-3-aminopyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: GAYPLCLHMMNIOS-HJXLNUONSA-N.
| Molecular formula | C5H11ClN2O2 |
|---|---|
| Molecular weight | 166.60 g/mol |
| IUPAC name | (2S,3R)-3-aminopyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | GAYPLCLHMMNIOS-HJXLNUONSA-N |
| SMILES | C1CN[C@@H]([C@@H]1N)C(=O)O.Cl |
Computed by PubChem (NCBI)