CAS 3569-01-5 is the registry number for Anthraquinone-2,1-benzacridone. Offered by: TRC. Available pack sizes: 100mg.
13H-naphtho[2,3-c]acridine-5,8,14-trione (CAS 3569-01-5) is a chemical compound with the molecular formula C21H11NO3 and a molecular weight of 325.3 g/mol. IUPAC name: 13H-naphtho[2,3-c]acridine-5,8,14-trione. InChIKey: BARVYLKNIVAHDY-UHFFFAOYSA-N.
| Molecular formula | C21H11NO3 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | 13H-naphtho[2,3-c]acridine-5,8,14-trione |
| InChIKey | BARVYLKNIVAHDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C4=C(C=C3)C(=O)C5=CC=CC=C5N4 |
Computed by PubChem (NCBI)