CAS 35692-59-2 is the registry number for (-)-1,6-Epoxyisodihydrocarveol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(1S,2S,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-ol (CAS 35692-59-2) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: (1S,2S,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-ol. InChIKey: OOALTXSJGCZLBF-QEYWKRMJSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | (1S,2S,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-ol |
| InChIKey | OOALTXSJGCZLBF-QEYWKRMJSA-N |
| SMILES | CC(=C)[C@H]1C[C@@H]([C@]2([C@@H](C1)O2)C)O |
Computed by PubChem (NCBI)