Products 357158-11-3
CAS 357158-11-3 appears in our catalog under these names: 1H-Tetrazole,1-(2-fluorophenyl)-(9CI), ≥97%, ≥97%, 1-(2-FLUOROPHENYL)TETRAZOLE, ≥97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.
1-(2-fluorophenyl)tetrazole (CAS 357158-11-3) is a chemical compound with the molecular formula C7H5FN4 and a molecular weight of 164.14 g/mol. IUPAC name: 1-(2-fluorophenyl)tetrazole. InChIKey: MFUBMUIURXSVRK-UHFFFAOYSA-N.
| Molecular formula | C7H5FN4 |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 1-(2-fluorophenyl)tetrazole |
| InChIKey | MFUBMUIURXSVRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=NN=N2)F |
Computed by PubChem (NCBI)