CAS 357334-83-9 appears in our catalog under these names: Brivaracetam Impurity 21, (S)-2-((S)-4-Isopropyl-2-oxopyrrolidin-1-yl)butanamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-2-[(4S)-2-oxo-4-propan-2-ylpyrrolidin-1-yl]butanamide (CAS 357334-83-9) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: (2S)-2-[(4S)-2-oxo-4-propan-2-ylpyrrolidin-1-yl]butanamide. InChIKey: FEJILBHRUARNKM-BDAKNGLRSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | (2S)-2-[(4S)-2-oxo-4-propan-2-ylpyrrolidin-1-yl]butanamide |
| InChIKey | FEJILBHRUARNKM-BDAKNGLRSA-N |
| SMILES | CC[C@@H](C(=O)N)N1C[C@@H](CC1=O)C(C)C |
Computed by PubChem (NCBI)