Products 35742-45-1

CAS 35742-45-1 is the registry number for N-Methyl Prochlorperazine Iodide. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2-chloro-10-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propyl]phenothiazine iodide (CAS 35742-45-1) is a chemical compound with the molecular formula C21H27ClIN3S and a molecular weight of 515.9 g/mol. IUPAC name: 2-chloro-10-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propyl]phenothiazine iodide. InChIKey: BIMUGSVDXHTKJF-UHFFFAOYSA-M.

Identity
Molecular formulaC21H27ClIN3S
Molecular weight515.9 g/mol
IUPAC name2-chloro-10-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propyl]phenothiazine iodide
InChIKeyBIMUGSVDXHTKJF-UHFFFAOYSA-M
SMILESC[N+]1(CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)C.[I-]

Computed by PubChem (NCBI)