CAS 35742-45-1 is the registry number for N-Methyl Prochlorperazine Iodide. Offered by: TRC. Available pack sizes: 250mg.
2-chloro-10-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propyl]phenothiazine iodide (CAS 35742-45-1) is a chemical compound with the molecular formula C21H27ClIN3S and a molecular weight of 515.9 g/mol. IUPAC name: 2-chloro-10-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propyl]phenothiazine iodide. InChIKey: BIMUGSVDXHTKJF-UHFFFAOYSA-M.
| Molecular formula | C21H27ClIN3S |
|---|---|
| Molecular weight | 515.9 g/mol |
| IUPAC name | 2-chloro-10-[3-(4,4-dimethylpiperazin-4-ium-1-yl)propyl]phenothiazine iodide |
| InChIKey | BIMUGSVDXHTKJF-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)C.[I-] |
Computed by PubChem (NCBI)