Products 357425-68-4
CAS 357425-68-4 appears in our catalog under these names: CP–601932, CP-601932, 99.74%, CP-601932, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 100 mg, 10 mg, 50 mg, 25 mg, 10mM/1mL, 5 mg.
(1R,8S)-4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene (CAS 357425-68-4) is a chemical compound with the molecular formula C12H12F3N and a molecular weight of 227.22 g/mol. IUPAC name: (1R,8S)-4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene. InChIKey: RNOBTWYQAWEZHH-SFYZADRCSA-N.
| Molecular formula | C12H12F3N |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | (1R,8S)-4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene |
| InChIKey | RNOBTWYQAWEZHH-SFYZADRCSA-N |
| SMILES | C1[C@@H]2CNC[C@H]1C3=C2C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)