CAS 35779-41-0 is the registry number for N-Cyanonor-LSD. Offered by: TRC. Available pack sizes: 0,5mg, 1mg, 2,5mg.
(6aR,9R)-7-cyano-N,N-diethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 35779-41-0) is a chemical compound with the molecular formula C20H22N4O and a molecular weight of 334.4 g/mol. IUPAC name: (6aR,9R)-7-cyano-N,N-diethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: PRJLFXBNAZPHEJ-RDTXWAMCSA-N.
| Molecular formula | C20H22N4O |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (6aR,9R)-7-cyano-N,N-diethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | PRJLFXBNAZPHEJ-RDTXWAMCSA-N |
| SMILES | CCN(CC)C(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C#N |
Computed by PubChem (NCBI)