CAS 35779-43-2 appears in our catalog under these names: Norlysergic Acid Diethylamide, >95% (HPLC), Norlysergic acid diethylamide. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 5mg, 1mg, 2mg.
(6aR,9R)-N,N-diethyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (CAS 35779-43-2) is a chemical compound with the molecular formula C19H23N3O and a molecular weight of 309.4 g/mol. IUPAC name: (6aR,9R)-N,N-diethyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide. InChIKey: SUXLVXOMPKZBOV-CXAGYDPISA-N.
| Molecular formula | C19H23N3O |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (6aR,9R)-N,N-diethyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | SUXLVXOMPKZBOV-CXAGYDPISA-N |
| SMILES | CCN(CC)C(=O)[C@H]1CN[C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1 |
Computed by PubChem (NCBI)