CAS 357981-14-7 appears in our catalog under these names: 1-Azido-β-D-glucuronic acid, 1-Azido-β-D-glucuronic acid, min. 95 %, 50 mg, 1-Azido-β-D-glucuronic acid, min. 95 %, 500 mg. Offered by: Biosynth, Roth. Available pack sizes: 0,5g, 50mg, 500mg.
(2S,3S,4S,5R,6R)-6-azido-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 357981-14-7) is a chemical compound with the molecular formula C6H9N3O6 and a molecular weight of 219.15 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-6-azido-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: HFKUSYWEILNCQU-CIOUUCGESA-N.
| Molecular formula | C6H9N3O6 |
|---|---|
| Molecular weight | 219.15 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-6-azido-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | HFKUSYWEILNCQU-CIOUUCGESA-N |
| SMILES | [C@@H]1([C@@H]([C@H](O[C@H]([C@@H]1O)N=[N+]=[N-])C(=O)O)O)O |
Computed by PubChem (NCBI)