CAS 35812-01-2 appears in our catalog under these names: N-Bromosaccharin, 98%, N–Bromosaccharin, N-Bromosaccharin, >98.0%(T), N-Bromosaccharin 98%, N-Bromosaccharin, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 15g.
2-bromo-1,1-dioxo-1,2-benzothiazol-3-one (CAS 35812-01-2) is a chemical compound with the molecular formula C7H4BrNO3S and a molecular weight of 262.08 g/mol. IUPAC name: 2-bromo-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: QRADPXNAURXMSB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3S |
|---|---|
| Molecular weight | 262.08 g/mol |
| IUPAC name | 2-bromo-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | QRADPXNAURXMSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)Br |
Computed by PubChem (NCBI)