CAS 3582-71-6 appears in our catalog under these names: 1,5-Dichlorohexamethyltrisiloxane, 95%, 1,5-Dichlorohexamethyltrisiloxane (~90%), 1,5–Dichloro–1,1,3,3,5,5–hexamethyltrisiloxane, 1,5-Dichloro-1,1,3,3,5,5-hexamethyltrisiloxane, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, TCI. Available pack sizes: 1g, 25g, 5g, 100mg, 500mg, 50mg.
Bis[[chloro(dimethyl)silyl]oxy]-dimethylsilane (CAS 3582-71-6) is a chemical compound with the molecular formula C6H18Cl2O2Si3 and a molecular weight of 277.36 g/mol. IUPAC name: bis[[chloro(dimethyl)silyl]oxy]-dimethylsilane. InChIKey: GJIYNWRLGOMDEX-UHFFFAOYSA-N.
| Molecular formula | C6H18Cl2O2Si3 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | bis[[chloro(dimethyl)silyl]oxy]-dimethylsilane |
| InChIKey | GJIYNWRLGOMDEX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O[Si](C)(C)Cl)O[Si](C)(C)Cl |
Computed by PubChem (NCBI)