CAS 3582-72-7 is the registry number for 1,3-Dichloro-1,3-dimethyl-1,3-diphenyldisiloxane. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
Chloro-(chloro-methyl-phenylsilyl)oxy-methyl-phenylsilane (CAS 3582-72-7) is a chemical compound with the molecular formula C14H16Cl2OSi2 and a molecular weight of 327.3 g/mol. IUPAC name: chloro-(chloro-methyl-phenylsilyl)oxy-methyl-phenylsilane. InChIKey: AUWRUFAJYVQXSH-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2OSi2 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | chloro-(chloro-methyl-phenylsilyl)oxy-methyl-phenylsilane |
| InChIKey | AUWRUFAJYVQXSH-UHFFFAOYSA-N |
| SMILES | C[Si](C1=CC=CC=C1)(O[Si](C)(C2=CC=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)