Products 35845-34-2
CAS 35845-34-2 is the registry number for Ethyl-d5 Crotonate. Offered by: TRC. Available pack sizes: 100mg.
1,1,2,2,2-pentadeuterioethyl (E)-but-2-enoate (CAS 35845-34-2) is a chemical compound with the molecular formula C6H10O2 and a molecular weight of 119.17 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl (E)-but-2-enoate. InChIKey: ZFDIRQKJPRINOQ-ISXCDJLESA-N.
| Molecular formula | C6H10O2 |
|---|---|
| Molecular weight | 119.17 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl (E)-but-2-enoate |
| InChIKey | ZFDIRQKJPRINOQ-ISXCDJLESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)/C=C/C |
Computed by PubChem (NCBI)
Synonyms:
Ethyl-d5 Crotonate, Ethyl-d5Crotonate