Products 35845-64-8
CAS 35845-64-8 appears in our catalog under these names: (2-Bromoethyl)benzene-d5, >95% (HPLC), (2-Bromoethyl)benzene-d5, 99 atom % D, min 98% Chemical Purity, (2-Bromoethyl)benzene-d5. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 1g, 0,5g, 100 mg, 500 mg, 1 g.
1-(2-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene (CAS 35845-64-8) is a chemical compound with the molecular formula C8H9Br and a molecular weight of 190.09 g/mol. IUPAC name: 1-(2-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene. InChIKey: WMPPDTMATNBGJN-RALIUCGRSA-N.
| Molecular formula | C8H9Br |
|---|---|
| Molecular weight | 190.09 g/mol |
| IUPAC name | 1-(2-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | WMPPDTMATNBGJN-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCBr)[2H])[2H] |
Computed by PubChem (NCBI)