Products 35849-41-3
CAS 35849-41-3 is the registry number for (S)-N-Formylsarcolysine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoic acid (CAS 35849-41-3) is a chemical compound with the molecular formula C14H18Cl2N2O3 and a molecular weight of 333.2 g/mol. IUPAC name: (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoic acid. InChIKey: ZPOLNCDBPYJDSE-ZDUSSCGKSA-N.
| Molecular formula | C14H18Cl2N2O3 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-formamidopropanoic acid |
| InChIKey | ZPOLNCDBPYJDSE-ZDUSSCGKSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC=O)N(CCCl)CCCl |
Computed by PubChem (NCBI)