Products 35850-94-3

CAS 35850-94-3 is the registry number for Sodium 1-hydroxypropane-1,3-disulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-hydroxypropane-1,3-disulfonic acid (CAS 35850-94-3) is a chemical compound with the molecular formula C3H8O7S2 and a molecular weight of 220.2 g/mol. IUPAC name: 1-hydroxypropane-1,3-disulfonic acid. InChIKey: PFEHYGDNXTWNDD-UHFFFAOYSA-N.

Identity
Molecular formulaC3H8O7S2
Molecular weight220.2 g/mol
IUPAC name1-hydroxypropane-1,3-disulfonic acid
InChIKeyPFEHYGDNXTWNDD-UHFFFAOYSA-N
SMILESC(CS(=O)(=O)O)C(O)S(=O)(=O)O

Computed by PubChem (NCBI)