CAS 35850-94-3 is the registry number for Sodium 1-hydroxypropane-1,3-disulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-hydroxypropane-1,3-disulfonic acid (CAS 35850-94-3) is a chemical compound with the molecular formula C3H8O7S2 and a molecular weight of 220.2 g/mol. IUPAC name: 1-hydroxypropane-1,3-disulfonic acid. InChIKey: PFEHYGDNXTWNDD-UHFFFAOYSA-N.
| Molecular formula | C3H8O7S2 |
|---|---|
| Molecular weight | 220.2 g/mol |
| IUPAC name | 1-hydroxypropane-1,3-disulfonic acid |
| InChIKey | PFEHYGDNXTWNDD-UHFFFAOYSA-N |
| SMILES | C(CS(=O)(=O)O)C(O)S(=O)(=O)O |
Computed by PubChem (NCBI)