CAS 3586-60-5 is the registry number for Asomate. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1g, 50mg.
Bis(dimethylcarbamothioylsulfanyl)arsanyl N,N-dimethylcarbamodithioate (CAS 3586-60-5) is a chemical compound with the molecular formula C9H18AsN3S6 and a molecular weight of 435.6 g/mol. IUPAC name: bis(dimethylcarbamothioylsulfanyl)arsanyl N,N-dimethylcarbamodithioate. InChIKey: GAMFEMAXLMWCRG-UHFFFAOYSA-N.
| Molecular formula | C9H18AsN3S6 |
|---|---|
| Molecular weight | 435.6 g/mol |
| IUPAC name | bis(dimethylcarbamothioylsulfanyl)arsanyl N,N-dimethylcarbamodithioate |
| InChIKey | GAMFEMAXLMWCRG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)S[As](SC(=S)N(C)C)SC(=S)N(C)C |
Computed by PubChem (NCBI)