CAS 358730-85-5 appears in our catalog under these names: O-(2,3,4,5,6-Pentafluorobenzyl-alpha,alpha-d2)hydroxylamine HCl, 98 atom % D, min 98% Chemical Purity, O-((Perfluorophenyl)methyl)hydroxylamine-d2 (hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1 mg.
O-[dideuterio-(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine;hydrochloride (CAS 358730-85-5) is a chemical compound with the molecular formula C7H5ClF5NO and a molecular weight of 251.58 g/mol. IUPAC name: O-[dideuterio-(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: HVMVKNXIMUCYJA-CUOKRTIESA-N.
| Molecular formula | C7H5ClF5NO |
|---|---|
| Molecular weight | 251.58 g/mol |
| IUPAC name | O-[dideuterio-(2,3,4,5,6-pentafluorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | HVMVKNXIMUCYJA-CUOKRTIESA-N |
| SMILES | [2H]C([2H])(C1=C(C(=C(C(=C1F)F)F)F)F)ON.Cl |
Computed by PubChem (NCBI)