Products 358730-87-7
CAS 358730-87-7 appears in our catalog under these names: 4-tert-Butylphenol-d9 (Major), >95% (HPLC), 4-tert-Butylphenol-d9. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.
4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]phenol (CAS 358730-87-7) is a chemical compound with the molecular formula C10H14O and a molecular weight of 159.27 g/mol. IUPAC name: 4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]phenol. InChIKey: QHPQWRBYOIRBIT-GQALSZNTSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 159.27 g/mol |
| IUPAC name | 4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]phenol |
| InChIKey | QHPQWRBYOIRBIT-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)