CAS 358731-05-2 is the registry number for tert-Butyl Acetate-d12, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] 2,2,2-trideuterioacetate (CAS 358731-05-2) is a chemical compound with the molecular formula C6H12O2 and a molecular weight of 128.23 g/mol. IUPAC name: [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] 2,2,2-trideuterioacetate. InChIKey: WMOVHXAZOJBABW-MGKWXGLJSA-N.
| Molecular formula | C6H12O2 |
|---|---|
| Molecular weight | 128.23 g/mol |
| IUPAC name | [1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl] 2,2,2-trideuterioacetate |
| InChIKey | WMOVHXAZOJBABW-MGKWXGLJSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)OC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)