CAS 35874-49-8 appears in our catalog under these names: 8-NH2-ATP, 8-Aminoadenosine-5'-triphosphate lithium salt - 100mM aqueous solution, 8-Aminoadenosine-5'-triphosphate sodium salt - 10mM aqueous solution. Offered by: MedChemExpress, Biosynth. Available pack sizes: Get quote, 2,5mg, 0,5mg, 5mg, 2mg, 1mg, 25mg, 10mg.
[[(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 35874-49-8) is a chemical compound with the molecular formula C10H17N6O13P3 and a molecular weight of 522.20 g/mol. IUPAC name: [[(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: FRQGDEVDOCHMCQ-UUOKFMHZSA-N.
| Molecular formula | C10H17N6O13P3 |
|---|---|
| Molecular weight | 522.20 g/mol |
| IUPAC name | [[(2R,3S,4R,5R)-5-(6,8-diaminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | FRQGDEVDOCHMCQ-UUOKFMHZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N |
Computed by PubChem (NCBI)