CAS 358775-08-3 is the registry number for 2-(4-((4-Nitrophenyl)methoxy)phenyl)-1,2,3-trihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5000mg.
2-[4-[(4-nitrophenyl)methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (CAS 358775-08-3) is a chemical compound with the molecular formula C21H17N3O4 and a molecular weight of 375.4 g/mol. IUPAC name: 2-[4-[(4-nitrophenyl)methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one. InChIKey: LGRAUNPKMPPZRE-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O4 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-[4-[(4-nitrophenyl)methoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| InChIKey | LGRAUNPKMPPZRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(N2)C3=CC=C(C=C3)OCC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)