Products 35889-99-7

CAS 35889-99-7 appears in our catalog under these names: Methyl 3-(tert-butoxy)-2,2-dimethylpropanoate, 95%, Methyl 3-(tert-butoxy)-2,2-dimethylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]propanoate (CAS 35889-99-7) is a chemical compound with the molecular formula C10H20O3 and a molecular weight of 188.26 g/mol. IUPAC name: methyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]propanoate. InChIKey: WMQFLGYAQQQGGW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20O3
Molecular weight188.26 g/mol
IUPAC namemethyl 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]propanoate
InChIKeyWMQFLGYAQQQGGW-UHFFFAOYSA-N
SMILESCC(C)(C)OCC(C)(C)C(=O)OC

Computed by PubChem (NCBI)