CAS 359-85-3 appears in our catalog under these names: 2H-Benzo(e)(1,2,4)thiadiazine 1,1-dioxide, 98%, 2H-1,2,4-Benzothiadiazine-1,1-dione, 2H-Benzo[e][1,2,4]thiadiazine 1,1-dioxide, 98%, 98%, 2H-1λâ¶,2,4-benzothiadiazine-1,1-dione, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 5g, 0,5g, 100mg, 250mg, 1g, 500mg, 2.5g.
4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 359-85-3) is a chemical compound with the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. IUPAC name: 4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: BBNGVMNBBLPZIR-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | BBNGVMNBBLPZIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC=NS2(=O)=O |
Computed by PubChem (NCBI)