Products 35910-16-8
CAS 35910-16-8 appears in our catalog under these names: Pterosin A, Pterosin A, Pterosin A, 94.07%, Pterosin A, 94%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
(2S)-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-3H-inden-1-one (CAS 35910-16-8) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: (2S)-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-3H-inden-1-one. InChIKey: BDZJLPDYMKPKGC-HNNXBMFYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (2S)-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-3H-inden-1-one |
| InChIKey | BDZJLPDYMKPKGC-HNNXBMFYSA-N |
| SMILES | CC1=CC2=C(C(=C1CCO)C)C(=O)[C@](C2)(C)CO |
Computed by PubChem (NCBI)