CAS 359399-97-6 is the registry number for 4,4'-Dibromo-[1,1'-biphenyl]-2,2',6,6'-tetracarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(4-bromo-2,6-dicarboxyphenyl)benzene-1,3-dicarboxylic acid (CAS 359399-97-6) is a chemical compound with the molecular formula C16H8Br2O8 and a molecular weight of 488.0 g/mol. IUPAC name: 5-bromo-2-(4-bromo-2,6-dicarboxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: IDEFJSAPELGLPY-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2O8 |
|---|---|
| Molecular weight | 488.0 g/mol |
| IUPAC name | 5-bromo-2-(4-bromo-2,6-dicarboxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | IDEFJSAPELGLPY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)C2=C(C=C(C=C2C(=O)O)Br)C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)