CAS 359436-55-8 appears in our catalog under these names: Isoguanosine hydrate, 95%, Isoguanosine Hydrate, Isoguanosine hydrate(1:x), 95%, 95%. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 100mg, 10mg, 50mg.
6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-2-one;hydrate (CAS 359436-55-8) is a chemical compound with the molecular formula C10H15N5O6 and a molecular weight of 301.26 g/mol. IUPAC name: 6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-2-one;hydrate. InChIKey: XJFGKAOCZWFNPZ-GWTDSMLYSA-N.
| Molecular formula | C10H15N5O6 |
|---|---|
| Molecular weight | 301.26 g/mol |
| IUPAC name | 6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-2-one;hydrate |
| InChIKey | XJFGKAOCZWFNPZ-GWTDSMLYSA-N |
| SMILES | C1=NC2=C(NC(=O)N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N.O |
Computed by PubChem (NCBI)