CAS 359436-89-8 appears in our catalog under these names: 7-Methoxycoumarin-4-acetic acid n-succinimidyl ester, 95%, 7-Methoxycoumarin-4-acetic Acid N-Succinimidyl Ester, 7–Methoxycoumarin–4–acetic Acid N–Succinimidyl Ester, MCA succinimidyl ester. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1000mg, 100 mg, 25 mg, 50 mg.
(2,5-dioxopyrrolidin-1-yl) 2-(7-methoxy-2-oxochromen-4-yl)acetate (CAS 359436-89-8) is a chemical compound with the molecular formula C16H13NO7 and a molecular weight of 331.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-(7-methoxy-2-oxochromen-4-yl)acetate. InChIKey: XYBYCKCNAJSBQE-UHFFFAOYSA-N.
| Molecular formula | C16H13NO7 |
|---|---|
| Molecular weight | 331.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-(7-methoxy-2-oxochromen-4-yl)acetate |
| InChIKey | XYBYCKCNAJSBQE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=O)O2)CC(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)