CAS 359436-90-1 is the registry number for (2-(7-Methoxy-2-oxo-2H-chromen-4-yl)acetyl)-L-proline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]pyrrolidine-2-carboxylic acid (CAS 359436-90-1) is a chemical compound with the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. IUPAC name: 1-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]pyrrolidine-2-carboxylic acid. InChIKey: SEFOAEFTUYEMLH-UHFFFAOYSA-N.
| Molecular formula | C17H17NO6 |
|---|---|
| Molecular weight | 331.32 g/mol |
| IUPAC name | 1-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]pyrrolidine-2-carboxylic acid |
| InChIKey | SEFOAEFTUYEMLH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=O)O2)CC(=O)N3CCCC3C(=O)O |
Computed by PubChem (NCBI)