CAS 35947-07-0 appears in our catalog under these names: Glycine Calcium Salt (2:1), Calcium glycinate, Calcium glycinate monohydrate, Calcium glycinate. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 100g, 25g, 500g, 5g, 50g, 250g, 1000g.
Calcium bis(2-aminoacetate) (CAS 35947-07-0) is a chemical compound with the molecular formula C4H8CaN2O4 and a molecular weight of 188.20 g/mol. IUPAC name: calcium bis(2-aminoacetate). InChIKey: OFNJDDJDXNMTHZ-UHFFFAOYSA-L.
| Molecular formula | C4H8CaN2O4 |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | calcium bis(2-aminoacetate) |
| InChIKey | OFNJDDJDXNMTHZ-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])N.C(C(=O)[O-])N.[Ca+2] |
Computed by PubChem (NCBI)