CAS 35980-13-3 is the registry number for Trimethyl(phenanthren-2-yl)silane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trimethyl(phenanthren-2-yl)silane (CAS 35980-13-3) is a chemical compound with the molecular formula C17H18Si and a molecular weight of 250.41 g/mol. IUPAC name: trimethyl(phenanthren-2-yl)silane. InChIKey: HTMXECIZDKAJLY-UHFFFAOYSA-N.
| Molecular formula | C17H18Si |
|---|---|
| Molecular weight | 250.41 g/mol |
| IUPAC name | trimethyl(phenanthren-2-yl)silane |
| InChIKey | HTMXECIZDKAJLY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC2=C(C=C1)C3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)